About 1-diazo-2,2-dimethylundecane
1-diazo-2,2-dimethylundecane (PubChem CID 151446398) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-diazo-2,2-dimethylundecane.
Molecular Properties
| Compound Name | 1-diazo-2,2-dimethylundecane |
| PubChem CID | 151446398 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-diazo-2,2-dimethylundecane |
| SMILES | CCCCCCCCCC(C)(C)C=[N+]=[N-] |
| InChI | InChI=1S/C13H26N2/c1-4-5-6-7-8-9-10-11-13(2,3)12-15-14/h12H,4-11H2,1-3H3 |
| InChIKey | PFOXVKSTYLRDTN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-2,2-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-2,2-dimethylundecane?
The IUPAC name of 1-diazo-2,2-dimethylundecane (CID 151446398) is 1-diazo-2,2-dimethylundecane.
What is the SMILES notation for 1-diazo-2,2-dimethylundecane?
The canonical SMILES for 1-diazo-2,2-dimethylundecane is CCCCCCCCCC(C)(C)C=[N+]=[N-].
What is the InChIKey of 1-diazo-2,2-dimethylundecane?
The InChIKey is PFOXVKSTYLRDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-4-5-6-7-8-9-10-11-13(2,3)12-15-14/h12H,4-11H2,1-3H3.
What are the key properties of 1-diazo-2,2-dimethylundecane?
1-diazo-2,2-dimethylundecane has a molecular weight of 210.36 g/mol, XLogP of 4.45, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-2,2-dimethylundecane is sourced from PubChem (CID 151446398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).