About 1,3-difluoro-1,3-dihydroxypropan-2-one
1,3-difluoro-1,3-dihydroxypropan-2-one (PubChem CID 151448255) has the molecular formula C3H4F2O3
and a molecular weight of 126.06 g/mol. Its IUPAC name is 1,3-difluoro-1,3-dihydroxypropan-2-one.
Molecular Properties
| Compound Name | 1,3-difluoro-1,3-dihydroxypropan-2-one |
| PubChem CID | 151448255 |
| Molecular Formula | C3H4F2O3 |
| Molecular Weight | 126.06 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | 1,3-difluoro-1,3-dihydroxypropan-2-one |
| SMILES | O=C(C(O)F)C(O)F |
| InChI | InChI=1S/C3H4F2O3/c4-2(7)1(6)3(5)8/h2-3,7-8H |
| InChIKey | PFYIOQDJEGCCMX-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.06 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-difluoro-1,3-dihydroxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-1,3-dihydroxypropan-2-one?
The IUPAC name of 1,3-difluoro-1,3-dihydroxypropan-2-one (CID 151448255) is 1,3-difluoro-1,3-dihydroxypropan-2-one.
What is the SMILES notation for 1,3-difluoro-1,3-dihydroxypropan-2-one?
The canonical SMILES for 1,3-difluoro-1,3-dihydroxypropan-2-one is O=C(C(O)F)C(O)F.
What is the InChIKey of 1,3-difluoro-1,3-dihydroxypropan-2-one?
The InChIKey is PFYIOQDJEGCCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F2O3/c4-2(7)1(6)3(5)8/h2-3,7-8H.
What are the key properties of 1,3-difluoro-1,3-dihydroxypropan-2-one?
1,3-difluoro-1,3-dihydroxypropan-2-one has a molecular weight of 126.06 g/mol, XLogP of -0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-1,3-dihydroxypropan-2-one is sourced from PubChem (CID 151448255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).