About 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide
2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide (PubChem CID 151448408) has the molecular formula C22H25F2N5
and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide.
Molecular Properties
| Compound Name | 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide |
| PubChem CID | 151448408 |
| Molecular Formula | C22H25F2N5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide |
| SMILES | CCN(CC)c1ccc(C/C(N)=N/c2ccn(Cc3ccc(F)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C22H25F2N5/c1-3-28(4-2)18-8-5-16(6-9-18)14-21(25)26-22-11-12-29(27-22)15-17-7-10-19(23)20(24)13-17/h5-13H,3-4,14-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | PFZDRFXLBBHFBU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide?
The IUPAC name of 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide (CID 151448408) is 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide.
What is the SMILES notation for 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide?
The canonical SMILES for 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide is CCN(CC)c1ccc(C/C(N)=N/c2ccn(Cc3ccc(F)c(F)c3)n2)cc1.
What is the InChIKey of 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide?
The InChIKey is PFZDRFXLBBHFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F2N5/c1-3-28(4-2)18-8-5-16(6-9-18)14-21(25)26-22-11-12-29(27-22)15-17-7-10-19(23)20(24)13-17/h5-13H,3-4,14-15H2,1-2H3,(H2,25,26,27).
What are the key properties of 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide?
2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide has a molecular weight of 397.47 g/mol, XLogP of 4.29, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(diethylamino)phenyl]-N'-[1-[(3,4-difluorophenyl)methyl]pyrazol-3-yl]ethanimidamide is sourced from PubChem (CID 151448408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).