About spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine]
spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] (PubChem CID 15144947) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine].
Molecular Properties
| Compound Name | spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] |
| PubChem CID | 15144947 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] |
| SMILES | c1cnc2c(c1)=NC1(CCCCC1)N=2 |
| InChI | InChI=1S/C11H13N3/c1-2-6-11(7-3-1)13-9-5-4-8-12-10(9)14-11/h4-5,8H,1-3,6-7H2 |
| InChIKey | IRFLWUABEAVYHH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine]?
The IUPAC name of spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] (CID 15144947) is spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine].
What is the SMILES notation for spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine]?
The canonical SMILES for spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] is c1cnc2c(c1)=NC1(CCCCC1)N=2.
What is the InChIKey of spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine]?
The InChIKey is IRFLWUABEAVYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-2-6-11(7-3-1)13-9-5-4-8-12-10(9)14-11/h4-5,8H,1-3,6-7H2.
What are the key properties of spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine]?
spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] has a molecular weight of 187.25 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclohexane-1,2'-imidazo[4,5-b]pyridine] is sourced from PubChem (CID 15144947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).