About 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one
9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one (PubChem CID 151451674) has the molecular formula C20H16BrNO3
and a molecular weight of 398.26 g/mol. Its IUPAC name is 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one.
Molecular Properties
| Compound Name | 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one |
| PubChem CID | 151451674 |
| Molecular Formula | C20H16BrNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one |
| SMILES | O=C1c2cc(Br)c(O)cc2C2(CCOCC2)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C20H16BrNO3/c21-14-9-12-13(10-16(14)23)20(5-7-25-8-6-20)19-17(18(12)24)11-3-1-2-4-15(11)22-19/h1-4,9-10,22-23H,5-8H2 |
| InChIKey | PGPPWDUCEWLDSZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one?
The IUPAC name of 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one (CID 151451674) is 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one.
What is the SMILES notation for 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one?
The canonical SMILES for 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one is O=C1c2cc(Br)c(O)cc2C2(CCOCC2)c2[nH]c3ccccc3c21.
What is the InChIKey of 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one?
The InChIKey is PGPPWDUCEWLDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrNO3/c21-14-9-12-13(10-16(14)23)20(5-7-25-8-6-20)19-17(18(12)24)11-3-1-2-4-15(11)22-19/h1-4,9-10,22-23H,5-8H2.
What are the key properties of 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one?
9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one has a molecular weight of 398.26 g/mol, XLogP of 4.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-8-hydroxyspiro[5H-benzo[b]carbazole-6,4'-oxane]-11-one is sourced from PubChem (CID 151451674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).