C18H15N3O3 — CID 15145308
6-amino-9-ethyl-3-phenyl-[1,3]oxazino[6,5-b]indole-2,4-dione (PubChem CID 15145308) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 6-amino-9-ethyl-3-phenyl-[1,3]oxazino[6,5-b]indole-2,4-dione.
| Compound Name | 6-amino-9-ethyl-3-phenyl-[1,3]oxazino[6,5-b]indole-2,4-dione |
|---|---|
| PubChem CID | 15145308 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 6-amino-9-ethyl-3-phenyl-[1,3]oxazino[6,5-b]indole-2,4-dione |
| SMILES | CCn1c2ccc(N)cc2c2c(=O)n(-c3ccccc3)c(=O)oc21 |
| InChI | InChI=1S/C18H15N3O3/c1-2-20-14-9-8-11(19)10-13(14)15-16(22)21(18(23)24-17(15)20)12-6-4-3-5-7-12/h3-10H,2,19H2,1H3 |
| InChIKey | YHJCHUURIBJWHK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|