C16H9N3O5 — CID 15145313
8-nitro-3-phenyl-[1,3,5]oxadiazino[3,2-a]indole-2,4-dione (PubChem CID 15145313) has the molecular formula C16H9N3O5 and a molecular weight of 323.26 g/mol. Its IUPAC name is 8-nitro-3-phenyl-[1,3,5]oxadiazino[3,2-a]indole-2,4-dione.
| Compound Name | 8-nitro-3-phenyl-[1,3,5]oxadiazino[3,2-a]indole-2,4-dione |
|---|---|
| PubChem CID | 15145313 |
| Molecular Formula | C16H9N3O5 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 8-nitro-3-phenyl-[1,3,5]oxadiazino[3,2-a]indole-2,4-dione |
| SMILES | O=c1oc2cc3cc([N+](=O)[O-])ccc3n2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H9N3O5/c20-15-17(11-4-2-1-3-5-11)16(21)24-14-9-10-8-12(19(22)23)6-7-13(10)18(14)15/h1-9H |
| InChIKey | FQSZRUGCPKOETP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|