C34H68N2O10 — CID 15145347
16-[10-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)decyl]-1,4,7,10,13-pentaoxa-16-azacyclooctadecane (PubChem CID 15145347) has the molecular formula C34H68N2O10 and a molecular weight of 664.92 g/mol. Its IUPAC name is 16-[10-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)decyl]-1,4,7,10,13-pentaoxa-16-azacyclooctadecane.
| Compound Name | 16-[10-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)decyl]-1,4,7,10,13-pentaoxa-16-azacyclooctadecane |
|---|---|
| PubChem CID | 15145347 |
| Molecular Formula | C34H68N2O10 |
| Molecular Weight | 664.92 g/mol |
| Exact Mass | 664.49 |
| IUPAC Name | 16-[10-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)decyl]-1,4,7,10,13-pentaoxa-16-azacyclooctadecane |
| SMILES | C(CCCCCN1CCOCCOCCOCCOCCOCC1)CCCCN1CCOCCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C34H68N2O10/c1(3-5-7-9-35-11-15-37-19-23-41-27-31-45-32-28-42-24-20-38-16-12-35)2-4-6-8-10-36-13-17-39-21-25-43-29-33-46-34-30-44-26-22-40-18-14-36/h1-34H2 |
| InChIKey | IOHAAUFRDMBTOB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.92 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|