C27H26N2O4 — CID 151454811
2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3,5-dimethylbenzamide (PubChem CID 151454811) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3,5-dimethylbenzamide.
| Compound Name | 2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 151454811 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C23C(=O)c4c(N)cccc4C2(O)Oc2cc(C(C)C)ccc23)c(C(N)=O)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-13(2)16-8-9-18-21(12-16)33-27(32)19-6-5-7-20(28)22(19)24(30)26(18,27)23-15(4)10-14(3)11-17(23)25(29)31/h5-13,32H,28H2,1-4H3,(H2,29,31) |
| InChIKey | PHFRAYSPAJYUTG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|