About S-ethyl 2-iodoethanethioate
S-ethyl 2-iodoethanethioate (PubChem CID 15145872) has the molecular formula C4H7IOS
and a molecular weight of 230.07 g/mol. Its IUPAC name is S-ethyl 2-iodoethanethioate.
Molecular Properties
| Compound Name | S-ethyl 2-iodoethanethioate |
| PubChem CID | 15145872 |
| Molecular Formula | C4H7IOS |
| Molecular Weight | 230.07 g/mol |
| Exact Mass | 229.93 |
| IUPAC Name | S-ethyl 2-iodoethanethioate |
| SMILES | CCSC(=O)CI |
| InChI | InChI=1S/C4H7IOS/c1-2-7-4(6)3-5/h2-3H2,1H3 |
| InChIKey | CNKMUZJCNZVMIP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.07 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 2-iodoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 2-iodoethanethioate?
The IUPAC name of S-ethyl 2-iodoethanethioate (CID 15145872) is S-ethyl 2-iodoethanethioate.
What is the SMILES notation for S-ethyl 2-iodoethanethioate?
The canonical SMILES for S-ethyl 2-iodoethanethioate is CCSC(=O)CI.
What is the InChIKey of S-ethyl 2-iodoethanethioate?
The InChIKey is CNKMUZJCNZVMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7IOS/c1-2-7-4(6)3-5/h2-3H2,1H3.
What are the key properties of S-ethyl 2-iodoethanethioate?
S-ethyl 2-iodoethanethioate has a molecular weight of 230.07 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 2-iodoethanethioate is sourced from PubChem (CID 15145872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).