C26H30NO2P — CID 15145878
tert-butyl N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]carbamate (PubChem CID 15145878) has the molecular formula C26H30NO2P and a molecular weight of 419.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15145878 |
| Molecular Formula | C26H30NO2P |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30NO2P/c1-26(2,3)29-25(28)27-22(19-21-13-7-4-8-14-21)20-30(23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,22H,19-20H2,1-3H3,(H,27,28)/t22-/m0/s1 |
| InChIKey | DGULVVDTQUYQRS-QFIPXVFZSA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|