About 1-fluoro-1,2-dihydrophthalazine
1-fluoro-1,2-dihydrophthalazine (PubChem CID 151464024) has the molecular formula C8H7FN2
and a molecular weight of 150.16 g/mol. Its IUPAC name is 1-fluoro-1,2-dihydrophthalazine.
Molecular Properties
| Compound Name | 1-fluoro-1,2-dihydrophthalazine |
| PubChem CID | 151464024 |
| Molecular Formula | C8H7FN2 |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 1-fluoro-1,2-dihydrophthalazine |
| SMILES | FC1NN=Cc2ccccc21 |
| InChI | InChI=1S/C8H7FN2/c9-8-7-4-2-1-3-6(7)5-10-11-8/h1-5,8,11H |
| InChIKey | PJBOAJNRXBUTDJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-1,2-dihydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-1,2-dihydrophthalazine?
The IUPAC name of 1-fluoro-1,2-dihydrophthalazine (CID 151464024) is 1-fluoro-1,2-dihydrophthalazine.
What is the SMILES notation for 1-fluoro-1,2-dihydrophthalazine?
The canonical SMILES for 1-fluoro-1,2-dihydrophthalazine is FC1NN=Cc2ccccc21.
What is the InChIKey of 1-fluoro-1,2-dihydrophthalazine?
The InChIKey is PJBOAJNRXBUTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2/c9-8-7-4-2-1-3-6(7)5-10-11-8/h1-5,8,11H.
What are the key properties of 1-fluoro-1,2-dihydrophthalazine?
1-fluoro-1,2-dihydrophthalazine has a molecular weight of 150.16 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-1,2-dihydrophthalazine is sourced from PubChem (CID 151464024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).