C10H20N6O8S2 — CID 151464727
2-[[2-[2-azidoethyl-[2-oxo-2-(2-sulfoethylamino)ethyl]amino]acetyl]amino]ethanesulfonic acid (PubChem CID 151464727) has the molecular formula C10H20N6O8S2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[[2-[2-azidoethyl-[2-oxo-2-(2-sulfoethylamino)ethyl]amino]acetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[2-azidoethyl-[2-oxo-2-(2-sulfoethylamino)ethyl]amino]acetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 151464727 |
| Molecular Formula | C10H20N6O8S2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[[2-[2-azidoethyl-[2-oxo-2-(2-sulfoethylamino)ethyl]amino]acetyl]amino]ethanesulfonic acid |
| SMILES | [N-]=[N+]=NCCN(CC(=O)NCCS(=O)(=O)O)CC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C10H20N6O8S2/c11-15-14-1-4-16(7-9(17)12-2-5-25(19,20)21)8-10(18)13-3-6-26(22,23)24/h1-8H2,(H,12,17)(H,13,18)(H,19,20,21)(H,22,23,24) |
| InChIKey | PJEXTFQNCUZPCO-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 218.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|