C27H37ClF2O4SSi — CID 151465022
tert-butyl-[6-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]hexan-2-yloxy]-dimethylsilane (PubChem CID 151465022) has the molecular formula C27H37ClF2O4SSi and a molecular weight of 559.19 g/mol. Its IUPAC name is tert-butyl-[6-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]hexan-2-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[6-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]hexan-2-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 151465022 |
| Molecular Formula | C27H37ClF2O4SSi |
| Molecular Weight | 559.19 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | tert-butyl-[6-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]hexan-2-yloxy]-dimethylsilane |
| SMILES | CC(CCCCC1COc2c(F)ccc(F)c2C1S(=O)(=O)c1ccc(Cl)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H37ClF2O4SSi/c1-18(34-36(5,6)27(2,3)4)9-7-8-10-19-17-33-25-23(30)16-15-22(29)24(25)26(19)35(31,32)21-13-11-20(28)12-14-21/h11-16,18-19,26H,7-10,17H2,1-6H3 |
| InChIKey | PJGKYMUXAAEEQK-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.19 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|