C9H14N4O4P+ — CID 151465670
hydroxy-[1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-oxophosphanium (PubChem CID 151465670) has the molecular formula C9H14N4O4P+ and a molecular weight of 273.21 g/mol. Its IUPAC name is hydroxy-[1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-oxophosphanium.
| Compound Name | hydroxy-[1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 151465670 |
| Molecular Formula | C9H14N4O4P+ |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | hydroxy-[1-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentyl]oxy-oxophosphanium |
| SMILES | O=[P+](O)OC1(CO)CCC(Nc2ncncn2)C1 |
| InChI | InChI=1S/C9H13N4O4P/c14-4-9(17-18(15)16)2-1-7(3-9)13-8-11-5-10-6-12-8/h5-7,14H,1-4H2,(H-,10,11,12,13,15,16)/p+1 |
| InChIKey | AWSPHSQEQSWBMF-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|