C22H44O4Si — CID 151467020
(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyl-2-[(Z)-non-1-enyl]oxan-3-ol (PubChem CID 151467020) has the molecular formula C22H44O4Si and a molecular weight of 400.68 g/mol. Its IUPAC name is (2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyl-2-[(Z)-non-1-enyl]oxan-3-ol.
| Compound Name | (2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyl-2-[(Z)-non-1-enyl]oxan-3-ol |
|---|---|
| PubChem CID | 151467020 |
| Molecular Formula | C22H44O4Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyl-2-[(Z)-non-1-enyl]oxan-3-ol |
| SMILES | CCCCCCC/C=C\[C@@H]1OC[C@H](C)[C@H](OC)[C@@]1(O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si/c1-9-10-11-12-13-14-15-16-19-22(23,20(24-6)18(2)17-25-19)26-27(7,8)21(3,4)5/h15-16,18-20,23H,9-14,17H2,1-8H3/b16-15-/t18-,19-,20-,22-/m0/s1 |
| InChIKey | PJRCCAGYASSZOM-SBDDDAIOSA-N |
| XLogP | 5.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|