C10H17N — CID 151468625
4-ethyl-2,3,3a,4,5,6-hexahydro-1H-indole (PubChem CID 151468625) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-ethyl-2,3,3a,4,5,6-hexahydro-1H-indole.
| Compound Name | 4-ethyl-2,3,3a,4,5,6-hexahydro-1H-indole |
|---|---|
| PubChem CID | 151468625 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-ethyl-2,3,3a,4,5,6-hexahydro-1H-indole |
| SMILES | CCC1CCC=C2NCCC21 |
| InChI | InChI=1S/C10H17N/c1-2-8-4-3-5-10-9(8)6-7-11-10/h5,8-9,11H,2-4,6-7H2,1H3 |
| InChIKey | PJZLZFIJSHHQKB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |