C35H46F12N2O2 — CID 151470345
2-amino-5-[2-[4-amino-5-hydroxy-2-(10,10,10-trifluorodecyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(10,10,10-trifluorodecyl)phenol (PubChem CID 151470345) has the molecular formula C35H46F12N2O2 and a molecular weight of 754.74 g/mol. Its IUPAC name is 2-amino-5-[2-[4-amino-5-hydroxy-2-(10,10,10-trifluorodecyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(10,10,10-trifluorodecyl)phenol.
| Compound Name | 2-amino-5-[2-[4-amino-5-hydroxy-2-(10,10,10-trifluorodecyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(10,10,10-trifluorodecyl)phenol |
|---|---|
| PubChem CID | 151470345 |
| Molecular Formula | C35H46F12N2O2 |
| Molecular Weight | 754.74 g/mol |
| Exact Mass | 754.34 |
| IUPAC Name | 2-amino-5-[2-[4-amino-5-hydroxy-2-(10,10,10-trifluorodecyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(10,10,10-trifluorodecyl)phenol |
| SMILES | Nc1cc(CCCCCCCCCC(F)(F)F)c(C(c2cc(O)c(N)cc2CCCCCCCCCC(F)(F)F)(C(F)(F)F)C(F)(F)F)cc1O |
| InChI | InChI=1S/C35H46F12N2O2/c36-31(37,38)17-13-9-5-1-3-7-11-15-23-19-27(48)29(50)21-25(23)33(34(42,43)44,35(45,46)47)26-22-30(51)28(49)20-24(26)16-12-8-4-2-6-10-14-18-32(39,40)41/h19-22,50-51H,1-18,48-49H2 |
| InChIKey | PKIIRRRYDCQMII-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.74 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|