About fluoromethyl pyrimidine-5-carboxylate
fluoromethyl pyrimidine-5-carboxylate (PubChem CID 151471551) has the molecular formula C6H5FN2O2
and a molecular weight of 156.12 g/mol. Its IUPAC name is fluoromethyl pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | fluoromethyl pyrimidine-5-carboxylate |
| PubChem CID | 151471551 |
| Molecular Formula | C6H5FN2O2 |
| Molecular Weight | 156.12 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | fluoromethyl pyrimidine-5-carboxylate |
| SMILES | O=C(OCF)c1cncnc1 |
| InChI | InChI=1S/C6H5FN2O2/c7-3-11-6(10)5-1-8-4-9-2-5/h1-2,4H,3H2 |
| InChIKey | PKOQOIKEOVWZSP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.12 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze fluoromethyl pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethyl pyrimidine-5-carboxylate?
The IUPAC name of fluoromethyl pyrimidine-5-carboxylate (CID 151471551) is fluoromethyl pyrimidine-5-carboxylate.
What is the SMILES notation for fluoromethyl pyrimidine-5-carboxylate?
The canonical SMILES for fluoromethyl pyrimidine-5-carboxylate is O=C(OCF)c1cncnc1.
What is the InChIKey of fluoromethyl pyrimidine-5-carboxylate?
The InChIKey is PKOQOIKEOVWZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2O2/c7-3-11-6(10)5-1-8-4-9-2-5/h1-2,4H,3H2.
What are the key properties of fluoromethyl pyrimidine-5-carboxylate?
fluoromethyl pyrimidine-5-carboxylate has a molecular weight of 156.12 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethyl pyrimidine-5-carboxylate is sourced from PubChem (CID 151471551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).