C10H12F4N2O2S — CID 151471864
2-N-(1,1,2,2-tetrafluoroethylsulfanyl)cyclohex-3-ene-1,2-dicarboxamide (PubChem CID 151471864) has the molecular formula C10H12F4N2O2S and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-N-(1,1,2,2-tetrafluoroethylsulfanyl)cyclohex-3-ene-1,2-dicarboxamide.
| Compound Name | 2-N-(1,1,2,2-tetrafluoroethylsulfanyl)cyclohex-3-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 151471864 |
| Molecular Formula | C10H12F4N2O2S |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-N-(1,1,2,2-tetrafluoroethylsulfanyl)cyclohex-3-ene-1,2-dicarboxamide |
| SMILES | NC(=O)C1CCC=CC1C(=O)NSC(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F4N2O2S/c11-9(12)10(13,14)19-16-8(18)6-4-2-1-3-5(6)7(15)17/h2,4-6,9H,1,3H2,(H2,15,17)(H,16,18) |
| InChIKey | PKQHURBTVMALTB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|