C10H18FNO — CID 151473201
(6S,7S,7aS)-6-fluoro-3,3,6,7-tetramethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole (PubChem CID 151473201) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (6S,7S,7aS)-6-fluoro-3,3,6,7-tetramethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (6S,7S,7aS)-6-fluoro-3,3,6,7-tetramethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 151473201 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (6S,7S,7aS)-6-fluoro-3,3,6,7-tetramethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole |
| SMILES | C[C@H]1[C@H]2COC(C)(C)N2C[C@@]1(C)F |
| InChI | InChI=1S/C10H18FNO/c1-7-8-5-13-9(2,3)12(8)6-10(7,4)11/h7-8H,5-6H2,1-4H3/t7-,8+,10+/m0/s1 |
| InChIKey | PKXJSDYCQYMVCU-QXFUBDJGSA-N |
| XLogP | 1.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |