About N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide
N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 151473261) has the molecular formula C7H8FN3O3
and a molecular weight of 201.16 g/mol. Its IUPAC name is N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| PubChem CID | 151473261 |
| Molecular Formula | C7H8FN3O3 |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCNC(=O)c1[nH]c(=O)[nH]c(=O)c1F |
| InChI | InChI=1S/C7H8FN3O3/c1-2-9-6(13)4-3(8)5(12)11-7(14)10-4/h2H2,1H3,(H,9,13)(H2,10,11,12,14) |
| InChIKey | PKXRWABWCBLGRS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The IUPAC name of N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide (CID 151473261) is N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide.
What is the SMILES notation for N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The canonical SMILES for N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide is CCNC(=O)c1[nH]c(=O)[nH]c(=O)c1F.
What is the InChIKey of N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The InChIKey is PKXRWABWCBLGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN3O3/c1-2-9-6(13)4-3(8)5(12)11-7(14)10-4/h2H2,1H3,(H,9,13)(H2,10,11,12,14).
What are the key properties of N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide?
N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide has a molecular weight of 201.16 g/mol, XLogP of -1.05, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxamide is sourced from PubChem (CID 151473261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).