C14H14F4NO3- — CID 151474530
1-(4-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-methoxycyclobutane-1-carboximidate (PubChem CID 151474530) has the molecular formula C14H14F4NO3- and a molecular weight of 320.26 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-methoxycyclobutane-1-carboximidate.
| Compound Name | 1-(4-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-methoxycyclobutane-1-carboximidate |
|---|---|
| PubChem CID | 151474530 |
| Molecular Formula | C14H14F4NO3- |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,2,3,3-tetrafluoro-N-methoxycyclobutane-1-carboximidate |
| SMILES | CCOc1ccc(C2(C([O-])=NOC)CC(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C14H15F4NO3/c1-3-22-10-6-4-9(5-7-10)12(11(20)19-21-2)8-13(15,16)14(12,17)18/h4-7H,3,8H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | PLDYIDUGCNWCHW-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 53.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|