C9H9F3NO3- — CID 151476885
(1S,6S)-6-[(2,2,2-trifluoroacetyl)amino]cyclohex-3-ene-1-carboxylate (PubChem CID 151476885) has the molecular formula C9H9F3NO3- and a molecular weight of 236.17 g/mol. Its IUPAC name is (1S,6S)-6-[(2,2,2-trifluoroacetyl)amino]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[(2,2,2-trifluoroacetyl)amino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 151476885 |
| Molecular Formula | C9H9F3NO3- |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (1S,6S)-6-[(2,2,2-trifluoroacetyl)amino]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CC=CC[C@@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c10-9(11,12)8(16)13-6-4-2-1-3-5(6)7(14)15/h1-2,5-6H,3-4H2,(H,13,16)(H,14,15)/p-1/t5-,6-/m0/s1 |
| InChIKey | PLQCVQHZXUUJQX-WDSKDSINSA-M |
| XLogP | -0.25 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|