C10H12F3N3OS2 — CID 151478182
5-(methoxyiminomethyl)-N-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-4-amine (PubChem CID 151478182) has the molecular formula C10H12F3N3OS2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 5-(methoxyiminomethyl)-N-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-4-amine.
| Compound Name | 5-(methoxyiminomethyl)-N-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 151478182 |
| Molecular Formula | C10H12F3N3OS2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-(methoxyiminomethyl)-N-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-4-amine |
| SMILES | CNc1nc(SCCC(F)=C(F)F)sc1C=NOC |
| InChI | InChI=1S/C10H12F3N3OS2/c1-14-9-7(5-15-17-2)19-10(16-9)18-4-3-6(11)8(12)13/h5,14H,3-4H2,1-2H3 |
| InChIKey | PLXBEVFMCSFGTR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|