C9H11FN2OS — CID 151479210
5-(2-fluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbaldehyde (PubChem CID 151479210) has the molecular formula C9H11FN2OS and a molecular weight of 214.26 g/mol. Its IUPAC name is 5-(2-fluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbaldehyde.
| Compound Name | 5-(2-fluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 151479210 |
| Molecular Formula | C9H11FN2OS |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 5-(2-fluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbaldehyde |
| SMILES | O=Cc1nc2c(s1)CN(CCF)CC2 |
| InChI | InChI=1S/C9H11FN2OS/c10-2-4-12-3-1-7-8(5-12)14-9(6-13)11-7/h6H,1-5H2 |
| InChIKey | PMCKQAPTEKLNEH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|