C10H10N4S — CID 15147975
N-prop-2-enyl-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine (PubChem CID 15147975) has the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. Its IUPAC name is N-prop-2-enyl-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-prop-2-enyl-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 15147975 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | N-prop-2-enyl-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C10H10N4S/c1-2-6-12-10-14-13-9(15-10)8-5-3-4-7-11-8/h2-5,7H,1,6H2,(H,12,14) |
| InChIKey | RUVOGSNRSFNCQS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|