C26H54N4 — CID 151481187
1,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine (PubChem CID 151481187) has the molecular formula C26H54N4 and a molecular weight of 422.75 g/mol. Its IUPAC name is 1,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine.
| Compound Name | 1,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine |
|---|---|
| PubChem CID | 151481187 |
| Molecular Formula | C26H54N4 |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 422.43 |
| IUPAC Name | 1,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine |
| SMILES | CCCCC(C1CC(C)(C)N(C)C(C)(C)C1)C(N)(N)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C26H54N4/c1-12-13-14-21(19-15-22(2,3)29(10)23(4,5)16-19)26(27,28)20-17-24(6,7)30(11)25(8,9)18-20/h19-21H,12-18,27-28H2,1-11H3 |
| InChIKey | PMMSXMUBFSVFNP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|