About 2-butylimino-1,2-diphenylethanone
2-butylimino-1,2-diphenylethanone (PubChem CID 15148494) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-butylimino-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-butylimino-1,2-diphenylethanone |
| PubChem CID | 15148494 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-butylimino-1,2-diphenylethanone |
| SMILES | CCCC/N=C(/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-2-3-14-19-17(15-10-6-4-7-11-15)18(20)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3/b19-17+ |
| InChIKey | WIBOOWQWYGKPMJ-HTXNQAPBSA-N |
| XLogP | 4.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butylimino-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylimino-1,2-diphenylethanone?
The IUPAC name of 2-butylimino-1,2-diphenylethanone (CID 15148494) is 2-butylimino-1,2-diphenylethanone.
What is the SMILES notation for 2-butylimino-1,2-diphenylethanone?
The canonical SMILES for 2-butylimino-1,2-diphenylethanone is CCCC/N=C(/C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-butylimino-1,2-diphenylethanone?
The InChIKey is WIBOOWQWYGKPMJ-HTXNQAPBSA-N. The full InChI is InChI=1S/C18H19NO/c1-2-3-14-19-17(15-10-6-4-7-11-15)18(20)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3/b19-17+.
What are the key properties of 2-butylimino-1,2-diphenylethanone?
2-butylimino-1,2-diphenylethanone has a molecular weight of 265.36 g/mol, XLogP of 4.16, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylimino-1,2-diphenylethanone is sourced from PubChem (CID 15148494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).