C24H28F3N5O2 — CID 151485273
3-[[3-methyl-4-[1-[[6-[4-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]amino]butyl]phenyl]methylamino]propanoic acid (PubChem CID 151485273) has the molecular formula C24H28F3N5O2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 3-[[3-methyl-4-[1-[[6-[4-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]amino]butyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[3-methyl-4-[1-[[6-[4-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]amino]butyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 151485273 |
| Molecular Formula | C24H28F3N5O2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 3-[[3-methyl-4-[1-[[6-[4-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]amino]butyl]phenyl]methylamino]propanoic acid |
| SMILES | CCCC(Nc1ccc(-n2cc(C(F)(F)F)cn2)nc1)c1ccc(CNCCC(=O)O)cc1C |
| InChI | InChI=1S/C24H28F3N5O2/c1-3-4-21(20-7-5-17(11-16(20)2)12-28-10-9-23(33)34)31-19-6-8-22(29-14-19)32-15-18(13-30-32)24(25,26)27/h5-8,11,13-15,21,28,31H,3-4,9-10,12H2,1-2H3,(H,33,34) |
| InChIKey | PNHXBHCAEPIVDP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|