C20H16F5N8+ — CID 151486137
6-(4-cyclopropyl-1,2,4-triazol-3-yl)-N-[4-[4-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]pyridin-1-ium-1-yl]pyridin-2-amine (PubChem CID 151486137) has the molecular formula C20H16F5N8+ and a molecular weight of 463.39 g/mol. Its IUPAC name is 6-(4-cyclopropyl-1,2,4-triazol-3-yl)-N-[4-[4-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]pyridin-1-ium-1-yl]pyridin-2-amine.
| Compound Name | 6-(4-cyclopropyl-1,2,4-triazol-3-yl)-N-[4-[4-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]pyridin-1-ium-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 151486137 |
| Molecular Formula | C20H16F5N8+ |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 6-(4-cyclopropyl-1,2,4-triazol-3-yl)-N-[4-[4-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]pyridin-1-ium-1-yl]pyridin-2-amine |
| SMILES | FC(F)(F)C(F)(F)c1cn(-c2cc[n+](Nc3cccc(-c4nncn4C4CC4)n3)cc2)cn1 |
| InChI | InChI=1S/C20H16F5N8/c21-19(22,20(23,24)25)16-10-31(11-26-16)13-6-8-32(9-7-13)30-17-3-1-2-15(28-17)18-29-27-12-33(18)14-4-5-14/h1-3,6-12,14H,4-5H2,(H,28,30)/q+1 |
| InChIKey | PNMNYXASGUAEAK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|