C13H11Cl2N — CID 151486682
6,8-dichloro-1,2,3,4-tetrahydroacridine (PubChem CID 151486682) has the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. Its IUPAC name is 6,8-dichloro-1,2,3,4-tetrahydroacridine.
| Compound Name | 6,8-dichloro-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 151486682 |
| Molecular Formula | C13H11Cl2N |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 6,8-dichloro-1,2,3,4-tetrahydroacridine |
| SMILES | Clc1cc(Cl)c2cc3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C13H11Cl2N/c14-9-6-11(15)10-5-8-3-1-2-4-12(8)16-13(10)7-9/h5-7H,1-4H2 |
| InChIKey | PNPKLGJARUSSQP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |