C12H22O2 — CID 15148724
3,4-bis(ethenyl)-2,5-dimethylhexane-2,5-diol (PubChem CID 15148724) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-2,5-dimethylhexane-2,5-diol.
| Compound Name | 3,4-bis(ethenyl)-2,5-dimethylhexane-2,5-diol |
|---|---|
| PubChem CID | 15148724 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3,4-bis(ethenyl)-2,5-dimethylhexane-2,5-diol |
| SMILES | C=CC(C(C=C)C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C12H22O2/c1-7-9(11(3,4)13)10(8-2)12(5,6)14/h7-10,13-14H,1-2H2,3-6H3 |
| InChIKey | PDBDEPUVUZQBEA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|