C17H30ClF5O3Si4 — CID 151487854
chloro-[[[dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 151487854) has the molecular formula C17H30ClF5O3Si4 and a molecular weight of 525.21 g/mol. Its IUPAC name is chloro-[[[dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | chloro-[[[dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 151487854 |
| Molecular Formula | C17H30ClF5O3Si4 |
| Molecular Weight | 525.21 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | chloro-[[[dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C[Si](C)(Cl)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H30ClF5O3Si4/c1-27(2,24-29(5,6)26-30(7,8)25-28(3,4)18)11-9-10-12-13(19)15(21)17(23)16(22)14(12)20/h9-11H2,1-8H3 |
| InChIKey | PNVJFAREOJSMIH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.21 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|