About tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate
tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 151492506) has the molecular formula C30H37NO3
and a molecular weight of 459.63 g/mol. Its IUPAC name is tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 151492506 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(N2CCCCC2)C=CC=C(COc2ccc(Cc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C30H37NO3/c1-29(2,3)34-28(32)30(31-19-8-5-9-20-31)18-10-13-26(22-30)23-33-27-16-14-25(15-17-27)21-24-11-6-4-7-12-24/h4,6-7,10-18H,5,8-9,19-23H2,1-3H3 |
| InChIKey | POTJJUGJGSMNIN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate (CID 151492506) is tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate is CC(C)(C)OC(=O)C1(N2CCCCC2)C=CC=C(COc2ccc(Cc3ccccc3)cc2)C1.
What is the InChIKey of tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is POTJJUGJGSMNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37NO3/c1-29(2,3)34-28(32)30(31-19-8-5-9-20-31)18-10-13-26(22-30)23-33-27-16-14-25(15-17-27)21-24-11-6-4-7-12-24/h4,6-7,10-18H,5,8-9,19-23H2,1-3H3.
What are the key properties of tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate?
tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 459.63 g/mol, XLogP of 6.11, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-[(4-benzylphenoxy)methyl]-1-piperidin-1-ylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 151492506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).