About 2-(phenoxy)oxane;zinc
2-(phenoxy)oxane;zinc (PubChem CID 151493414) has the molecular formula C11H13O2Zn-
and a molecular weight of 242.61 g/mol. Its IUPAC name is 2-(phenoxy)oxane;zinc.
Molecular Properties
| Compound Name | 2-(phenoxy)oxane;zinc |
| PubChem CID | 151493414 |
| Molecular Formula | C11H13O2Zn- |
| Molecular Weight | 242.61 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-(phenoxy)oxane;zinc |
| SMILES | [Zn].[c-]1cccc(OC2CCCCO2)c1 |
| InChI | InChI=1S/C11H13O2.Zn/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;/h1-2,6-7,11H,4-5,8-9H2;/q-1; |
| InChIKey | NJSONFNXOILCIY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(phenoxy)oxane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenoxy)oxane;zinc?
The IUPAC name of 2-(phenoxy)oxane;zinc (CID 151493414) is 2-(phenoxy)oxane;zinc.
What is the SMILES notation for 2-(phenoxy)oxane;zinc?
The canonical SMILES for 2-(phenoxy)oxane;zinc is [Zn].[c-]1cccc(OC2CCCCO2)c1.
What is the InChIKey of 2-(phenoxy)oxane;zinc?
The InChIKey is NJSONFNXOILCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2.Zn/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;/h1-2,6-7,11H,4-5,8-9H2;/q-1;.
What are the key properties of 2-(phenoxy)oxane;zinc?
2-(phenoxy)oxane;zinc has a molecular weight of 242.61 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenoxy)oxane;zinc is sourced from PubChem (CID 151493414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).