About 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide
4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide (PubChem CID 15149788) has the molecular formula C17H15ClN4O2
and a molecular weight of 342.79 g/mol. Its IUPAC name is 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide |
| PubChem CID | 15149788 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide |
| SMILES | CN1N=C(c2ccccc2)CN(NC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H15ClN4O2/c1-21-17(24)22(11-15(19-21)12-5-3-2-4-6-12)20-16(23)13-7-9-14(18)10-8-13/h2-10H,11H2,1H3,(H,20,23) |
| InChIKey | UPHYKQVPJFACLE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide?
The IUPAC name of 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide (CID 15149788) is 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide.
What is the SMILES notation for 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide?
The canonical SMILES for 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide is CN1N=C(c2ccccc2)CN(NC(=O)c2ccc(Cl)cc2)C1=O.
What is the InChIKey of 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide?
The InChIKey is UPHYKQVPJFACLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN4O2/c1-21-17(24)22(11-15(19-21)12-5-3-2-4-6-12)20-16(23)13-7-9-14(18)10-8-13/h2-10H,11H2,1H3,(H,20,23).
What are the key properties of 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide?
4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide has a molecular weight of 342.79 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2-methyl-3-oxo-6-phenyl-5H-1,2,4-triazin-4-yl)benzamide is sourced from PubChem (CID 15149788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).