C19H19ClN4O2 — CID 151500164
methyl 2-[2-[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]ethyl]-3-chlorobenzoate (PubChem CID 151500164) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is methyl 2-[2-[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]ethyl]-3-chlorobenzoate.
| Compound Name | methyl 2-[2-[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]ethyl]-3-chlorobenzoate |
|---|---|
| PubChem CID | 151500164 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 2-[2-[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]ethyl]-3-chlorobenzoate |
| SMILES | COC(=O)c1cccc(Cl)c1CCc1nnc(-c2ccc(N)cc2)n1C |
| InChI | InChI=1S/C19H19ClN4O2/c1-24-17(22-23-18(24)12-6-8-13(21)9-7-12)11-10-14-15(19(25)26-2)4-3-5-16(14)20/h3-9H,10-11,21H2,1-2H3 |
| InChIKey | PQGDLLZUFUOKHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|