C12H13Cl3O4 — CID 15150212
ethyl (1S,6R)-7,7,8-trichloro-1,5-dimethyl-3-oxo-2-oxabicyclo[4.2.0]oct-4-ene-6-carboxylate (PubChem CID 15150212) has the molecular formula C12H13Cl3O4 and a molecular weight of 327.59 g/mol. Its IUPAC name is ethyl (1S,6R)-7,7,8-trichloro-1,5-dimethyl-3-oxo-2-oxabicyclo[4.2.0]oct-4-ene-6-carboxylate.
| Compound Name | ethyl (1S,6R)-7,7,8-trichloro-1,5-dimethyl-3-oxo-2-oxabicyclo[4.2.0]oct-4-ene-6-carboxylate |
|---|---|
| PubChem CID | 15150212 |
| Molecular Formula | C12H13Cl3O4 |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | ethyl (1S,6R)-7,7,8-trichloro-1,5-dimethyl-3-oxo-2-oxabicyclo[4.2.0]oct-4-ene-6-carboxylate |
| SMILES | CCOC(=O)[C@@]12C(C)=CC(=O)O[C@]1(C)C(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3O4/c1-4-18-9(17)11-6(2)5-7(16)19-10(11,3)8(13)12(11,14)15/h5,8H,4H2,1-3H3/t8?,10-,11+/m1/s1 |
| InChIKey | UEFJPKSVJGCWIY-JROPRLTOSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|