About bis(acetonitrile);dichloropalladium
bis(acetonitrile);dichloropalladium (PubChem CID 15150345) has the molecular formula C4H4Cl2N2Pd-2
and a molecular weight of 257.42 g/mol. Its IUPAC name is bis(acetonitrile);dichloropalladium.
Molecular Properties
| Compound Name | bis(acetonitrile);dichloropalladium |
| PubChem CID | 15150345 |
| Molecular Formula | C4H4Cl2N2Pd-2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 255.88 |
| IUPAC Name | bis(acetonitrile);dichloropalladium |
| SMILES | Cl[Pd]Cl.[CH2-]C#N.[CH2-]C#N |
| InChI | InChI=1S/2C2H2N.2ClH.Pd/c2*1-2-3;;;/h2*1H2;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | OOZYVEKOYRASHA-UHFFFAOYSA-L |
| XLogP | 2.06 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(acetonitrile);dichloropalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(acetonitrile);dichloropalladium?
The IUPAC name of bis(acetonitrile);dichloropalladium (CID 15150345) is bis(acetonitrile);dichloropalladium.
What is the SMILES notation for bis(acetonitrile);dichloropalladium?
The canonical SMILES for bis(acetonitrile);dichloropalladium is Cl[Pd]Cl.[CH2-]C#N.[CH2-]C#N.
What is the InChIKey of bis(acetonitrile);dichloropalladium?
The InChIKey is OOZYVEKOYRASHA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H2N.2ClH.Pd/c2*1-2-3;;;/h2*1H2;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of bis(acetonitrile);dichloropalladium?
bis(acetonitrile);dichloropalladium has a molecular weight of 257.42 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(acetonitrile);dichloropalladium is sourced from PubChem (CID 15150345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).