C30H36N2OS — CID 15150389
4-methyl-N-phenyl-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide (PubChem CID 15150389) has the molecular formula C30H36N2OS and a molecular weight of 472.70 g/mol. Its IUPAC name is 4-methyl-N-phenyl-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide.
| Compound Name | 4-methyl-N-phenyl-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide |
|---|---|
| PubChem CID | 15150389 |
| Molecular Formula | C30H36N2OS |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-methyl-N-phenyl-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(C(=S)C2=C(N3CCCCC3)C3(C)CCC2C3(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N2OS/c1-21-13-15-22(16-14-21)27(33)32(23-11-7-5-8-12-23)28(34)25-24-17-18-30(4,29(24,2)3)26(25)31-19-9-6-10-20-31/h5,7-8,11-16,24H,6,9-10,17-20H2,1-4H3 |
| InChIKey | YCUNRGGUCWOEMM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|