C14H26O4 — CID 151510139
4-ethoxy-4-methoxy-2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 151510139) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-ethoxy-4-methoxy-2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | 4-ethoxy-4-methoxy-2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 151510139 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-ethoxy-4-methoxy-2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CCOC(OC)(C(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26O4/c1-9-18-14(17-8,10(15)12(2,3)4)11(16)13(5,6)7/h9H2,1-8H3 |
| InChIKey | PSGXLVFDRABBNK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|