C17H22BFN2O — CID 151510962
3-(4-fluorophenyl)-1-methyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazole (PubChem CID 151510962) has the molecular formula C17H22BFN2O and a molecular weight of 300.19 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-methyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazole.
| Compound Name | 3-(4-fluorophenyl)-1-methyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 151510962 |
| Molecular Formula | C17H22BFN2O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-(4-fluorophenyl)-1-methyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazole |
| SMILES | Cn1cc(B2CC(C)(C)C(C)(C)O2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H22BFN2O/c1-16(2)11-18(22-17(16,3)4)14-10-21(5)20-15(14)12-6-8-13(19)9-7-12/h6-10H,11H2,1-5H3 |
| InChIKey | PSLQTZYXBDPINC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|