C29H35F3N2O3 — CID 151512419
1-[[4-[N-[1-(4-cyclohexylphenyl)-2,2,2-trifluoroethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 151512419) has the molecular formula C29H35F3N2O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is 1-[[4-[N-[1-(4-cyclohexylphenyl)-2,2,2-trifluoroethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[N-[1-(4-cyclohexylphenyl)-2,2,2-trifluoroethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 151512419 |
| Molecular Formula | C29H35F3N2O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 1-[[4-[N-[1-(4-cyclohexylphenyl)-2,2,2-trifluoroethoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCc1cc(C(C)=NOC(c2ccc(C3CCCCC3)cc2)C(F)(F)F)ccc1CN1CC(C(=O)O)C1 |
| InChI | InChI=1S/C29H35F3N2O3/c1-3-20-15-24(13-14-25(20)16-34-17-26(18-34)28(35)36)19(2)33-37-27(29(30,31)32)23-11-9-22(10-12-23)21-7-5-4-6-8-21/h9-15,21,26-27H,3-8,16-18H2,1-2H3,(H,35,36) |
| InChIKey | PSTFBEQZKBXUMX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|