About 2-butyldeca-2,3-dienal
2-butyldeca-2,3-dienal (PubChem CID 15151544) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 2-butyldeca-2,3-dienal.
Molecular Properties
| Compound Name | 2-butyldeca-2,3-dienal |
| PubChem CID | 15151544 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-butyldeca-2,3-dienal |
| SMILES | CCCCCCC=C=C(C=O)CCCC |
| InChI | InChI=1S/C14H24O/c1-3-5-7-8-9-10-12-14(13-15)11-6-4-2/h10,13H,3-9,11H2,1-2H3 |
| InChIKey | XDYUKJALIKYCGS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butyldeca-2,3-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyldeca-2,3-dienal?
The IUPAC name of 2-butyldeca-2,3-dienal (CID 15151544) is 2-butyldeca-2,3-dienal.
What is the SMILES notation for 2-butyldeca-2,3-dienal?
The canonical SMILES for 2-butyldeca-2,3-dienal is CCCCCCC=C=C(C=O)CCCC.
What is the InChIKey of 2-butyldeca-2,3-dienal?
The InChIKey is XDYUKJALIKYCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O/c1-3-5-7-8-9-10-12-14(13-15)11-6-4-2/h10,13H,3-9,11H2,1-2H3.
What are the key properties of 2-butyldeca-2,3-dienal?
2-butyldeca-2,3-dienal has a molecular weight of 208.34 g/mol, XLogP of 4.43, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyldeca-2,3-dienal is sourced from PubChem (CID 15151544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).