C17H22O5Se — CID 15151593
dimethyl 2-[[(3S,4R)-4-(phenylselanylmethyl)oxolan-3-yl]methyl]propanedioate (PubChem CID 15151593) has the molecular formula C17H22O5Se and a molecular weight of 385.32 g/mol. Its IUPAC name is dimethyl 2-[[(3S,4R)-4-(phenylselanylmethyl)oxolan-3-yl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[(3S,4R)-4-(phenylselanylmethyl)oxolan-3-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 15151593 |
| Molecular Formula | C17H22O5Se |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | dimethyl 2-[[(3S,4R)-4-(phenylselanylmethyl)oxolan-3-yl]methyl]propanedioate |
| SMILES | COC(=O)C(C[C@@H]1COC[C@@H]1C[Se]c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C17H22O5Se/c1-20-16(18)15(17(19)21-2)8-12-9-22-10-13(12)11-23-14-6-4-3-5-7-14/h3-7,12-13,15H,8-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | SQKUAAIXZCUQCW-CHWSQXEVSA-N |
| XLogP | 1.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|