C19H10F6O4 — CID 151521868
3,4,6-trifluoro-5-[2-(2,3,6-trifluoro-4,5-diformylphenyl)propan-2-yl]phthalaldehyde (PubChem CID 151521868) has the molecular formula C19H10F6O4 and a molecular weight of 416.27 g/mol. Its IUPAC name is 3,4,6-trifluoro-5-[2-(2,3,6-trifluoro-4,5-diformylphenyl)propan-2-yl]phthalaldehyde.
| Compound Name | 3,4,6-trifluoro-5-[2-(2,3,6-trifluoro-4,5-diformylphenyl)propan-2-yl]phthalaldehyde |
|---|---|
| PubChem CID | 151521868 |
| Molecular Formula | C19H10F6O4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 3,4,6-trifluoro-5-[2-(2,3,6-trifluoro-4,5-diformylphenyl)propan-2-yl]phthalaldehyde |
| SMILES | CC(C)(c1c(F)c(F)c(C=O)c(C=O)c1F)c1c(F)c(F)c(C=O)c(C=O)c1F |
| InChI | InChI=1S/C19H10F6O4/c1-19(2,11-13(20)7(3-26)9(5-28)15(22)17(11)24)12-14(21)8(4-27)10(6-29)16(23)18(12)25/h3-6H,1-2H3 |
| InChIKey | PUQMYDACNJDANS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|