About 6-chloro-4,4-dimethylazepan-2-one
6-chloro-4,4-dimethylazepan-2-one (PubChem CID 15152231) has the molecular formula C8H14ClNO
and a molecular weight of 175.66 g/mol. Its IUPAC name is 6-chloro-4,4-dimethylazepan-2-one.
Molecular Properties
| Compound Name | 6-chloro-4,4-dimethylazepan-2-one |
| PubChem CID | 15152231 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 6-chloro-4,4-dimethylazepan-2-one |
| SMILES | CC1(C)CC(=O)NCC(Cl)C1 |
| InChI | InChI=1S/C8H14ClNO/c1-8(2)3-6(9)5-10-7(11)4-8/h6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | HZCKYCZTVOTLSM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4,4-dimethylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4,4-dimethylazepan-2-one?
The IUPAC name of 6-chloro-4,4-dimethylazepan-2-one (CID 15152231) is 6-chloro-4,4-dimethylazepan-2-one.
What is the SMILES notation for 6-chloro-4,4-dimethylazepan-2-one?
The canonical SMILES for 6-chloro-4,4-dimethylazepan-2-one is CC1(C)CC(=O)NCC(Cl)C1.
What is the InChIKey of 6-chloro-4,4-dimethylazepan-2-one?
The InChIKey is HZCKYCZTVOTLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNO/c1-8(2)3-6(9)5-10-7(11)4-8/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 6-chloro-4,4-dimethylazepan-2-one?
6-chloro-4,4-dimethylazepan-2-one has a molecular weight of 175.66 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4,4-dimethylazepan-2-one is sourced from PubChem (CID 15152231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).