About 5,6-dimethylquinazoline-2,4-diamine
5,6-dimethylquinazoline-2,4-diamine (PubChem CID 15152355) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 5,6-dimethylquinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 5,6-dimethylquinazoline-2,4-diamine |
| PubChem CID | 15152355 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 5,6-dimethylquinazoline-2,4-diamine |
| SMILES | Cc1ccc2nc(N)nc(N)c2c1C |
| InChI | InChI=1S/C10H12N4/c1-5-3-4-7-8(6(5)2)9(11)14-10(12)13-7/h3-4H,1-2H3,(H4,11,12,13,14) |
| InChIKey | HPRNBMGYEBRSGZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethylquinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylquinazoline-2,4-diamine?
The IUPAC name of 5,6-dimethylquinazoline-2,4-diamine (CID 15152355) is 5,6-dimethylquinazoline-2,4-diamine.
What is the SMILES notation for 5,6-dimethylquinazoline-2,4-diamine?
The canonical SMILES for 5,6-dimethylquinazoline-2,4-diamine is Cc1ccc2nc(N)nc(N)c2c1C.
What is the InChIKey of 5,6-dimethylquinazoline-2,4-diamine?
The InChIKey is HPRNBMGYEBRSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-5-3-4-7-8(6(5)2)9(11)14-10(12)13-7/h3-4H,1-2H3,(H4,11,12,13,14).
What are the key properties of 5,6-dimethylquinazoline-2,4-diamine?
5,6-dimethylquinazoline-2,4-diamine has a molecular weight of 188.23 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylquinazoline-2,4-diamine is sourced from PubChem (CID 15152355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).