About [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate
[2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate (PubChem CID 151528019) has the molecular formula C19H33O5P
and a molecular weight of 372.44 g/mol. Its IUPAC name is [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate.
Molecular Properties
| Compound Name | [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate |
| PubChem CID | 151528019 |
| Molecular Formula | C19H33O5P |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OCC(Cc1ccc(O)cc1)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H33O5P/c1-8-23-25(21,22)24-14-19(17(2,3)4,18(5,6)7)13-15-9-11-16(20)12-10-15/h9-12,20H,8,13-14H2,1-7H3,(H,21,22) |
| InChIKey | PVWOJUYABJOKHN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate?
The IUPAC name of [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate (CID 151528019) is [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate.
What is the SMILES notation for [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate?
The canonical SMILES for [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate is CCOP(=O)(O)OCC(Cc1ccc(O)cc1)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate?
The InChIKey is PVWOJUYABJOKHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33O5P/c1-8-23-25(21,22)24-14-19(17(2,3)4,18(5,6)7)13-15-9-11-16(20)12-10-15/h9-12,20H,8,13-14H2,1-7H3,(H,21,22).
What are the key properties of [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate?
[2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate has a molecular weight of 372.44 g/mol, XLogP of 5.17, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-tert-butyl-2-[(4-hydroxyphenyl)methyl]-3,3-dimethylbutyl] ethyl hydrogen phosphate is sourced from PubChem (CID 151528019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).